4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid

C13H10Cl2N2O2 — CID 81233036

IUPAC4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid
SMILESCc1cc(Nc2cc(Cl)cc(Cl)c2)c(C(=O)O)cn1
InChIInChI=1S/C13H10Cl2N2O2/c1-7-2-12(11(6-16-7)13(18)19)17-10-4-8(14)3-9(15)5-10/h2-6H,1H3,(H,16,17)(H,18,19)
InChIKeyGXSGCTDNPHIBSR-UHFFFAOYSA-N
MW297.14 g/mol
LogP4.14
Rot. Bonds3

About 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid

4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid (PubChem CID 81233036) has the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.14 g/mol. Its IUPAC name is 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid
PubChem CID81233036
Molecular FormulaC13H10Cl2N2O2
Molecular Weight297.14 g/mol
Exact Mass296.01
IUPAC Name4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid
SMILESCc1cc(Nc2cc(Cl)cc(Cl)c2)c(C(=O)O)cn1
InChIInChI=1S/C13H10Cl2N2O2/c1-7-2-12(11(6-16-7)13(18)19)17-10-4-8(14)3-9(15)5-10/h2-6H,1H3,(H,16,17)(H,18,19)
InChIKeyGXSGCTDNPHIBSR-UHFFFAOYSA-N
XLogP4.14
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.14
LogP ≤ 54.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid?
The IUPAC name of 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid (CID 81233036) is 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid.
What is the SMILES notation for 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid?
The canonical SMILES for 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid is Cc1cc(Nc2cc(Cl)cc(Cl)c2)c(C(=O)O)cn1.
What is the InChIKey of 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid?
The InChIKey is GXSGCTDNPHIBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O2/c1-7-2-12(11(6-16-7)13(18)19)17-10-4-8(14)3-9(15)5-10/h2-6H,1H3,(H,16,17)(H,18,19).
What are the key properties of 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid?
4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid has a molecular weight of 297.14 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichloroanilino)-6-methylpyridine-3-carboxylic acid is sourced from PubChem (CID 81233036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).