C16H17ClN2 — CID 81234156
2-[3-(chloromethyl)-4-pyridinyl]-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 81234156) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-4-pyridinyl]-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-[3-(chloromethyl)-4-pyridinyl]-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 81234156 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[3-(chloromethyl)-4-pyridinyl]-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | ClCc1cnccc1N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C16H17ClN2/c17-10-15-11-18-8-7-16(15)19-9-3-6-13-4-1-2-5-14(13)12-19/h1-2,4-5,7-8,11H,3,6,9-10,12H2 |
| InChIKey | LRRDZWXYAQAOIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|