C15H15ClN2O2S — CID 81235906
2-chloro-N-[1-(3-nitrophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 81235906) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-nitrophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
| Compound Name | 2-chloro-N-[1-(3-nitrophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
|---|---|
| PubChem CID | 81235906 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-chloro-N-[1-(3-nitrophenyl)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | CC(NC1CCc2sc(Cl)cc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15ClN2O2S/c1-9(10-3-2-4-11(7-10)18(19)20)17-13-5-6-14-12(13)8-15(16)21-14/h2-4,7-9,13,17H,5-6H2,1H3 |
| InChIKey | RTBBNFICGOYAPM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|