C11H17N3O — CID 81236376
4-amino-N,N-diethyl-6-methylpyridine-3-carboxamide (PubChem CID 81236376) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-amino-N,N-diethyl-6-methylpyridine-3-carboxamide.
| Compound Name | 4-amino-N,N-diethyl-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81236376 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 4-amino-N,N-diethyl-6-methylpyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnc(C)cc1N |
| InChI | InChI=1S/C11H17N3O/c1-4-14(5-2)11(15)9-7-13-8(3)6-10(9)12/h6-7H,4-5H2,1-3H3,(H2,12,13) |
| InChIKey | YWJMTVLOGINMNT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |