About [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol
[4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol (PubChem CID 81236983) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol |
| PubChem CID | 81236983 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol |
| SMILES | CC1CN(c2ccncc2CO)CCN1C |
| InChI | InChI=1S/C12H19N3O/c1-10-8-15(6-5-14(10)2)12-3-4-13-7-11(12)9-16/h3-4,7,10,16H,5-6,8-9H2,1-2H3 |
| InChIKey | OAMNNTDVVNTCDR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol?
The IUPAC name of [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol (CID 81236983) is [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol.
What is the SMILES notation for [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol?
The canonical SMILES for [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol is CC1CN(c2ccncc2CO)CCN1C.
What is the InChIKey of [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol?
The InChIKey is OAMNNTDVVNTCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-10-8-15(6-5-14(10)2)12-3-4-13-7-11(12)9-16/h3-4,7,10,16H,5-6,8-9H2,1-2H3.
What are the key properties of [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol?
[4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol has a molecular weight of 221.30 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dimethylpiperazin-1-yl)-3-pyridinyl]methanol is sourced from PubChem (CID 81236983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).