C17H16ClFOS — CID 81237876
2-chloro-2-(4-fluorophenyl)-1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethanone (PubChem CID 81237876) has the molecular formula C17H16ClFOS and a molecular weight of 322.83 g/mol. Its IUPAC name is 2-chloro-2-(4-fluorophenyl)-1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethanone.
| Compound Name | 2-chloro-2-(4-fluorophenyl)-1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 81237876 |
| Molecular Formula | C17H16ClFOS |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-chloro-2-(4-fluorophenyl)-1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)ethanone |
| SMILES | O=C(c1cc2c(s1)CCCCC2)C(Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16ClFOS/c18-16(11-6-8-13(19)9-7-11)17(20)15-10-12-4-2-1-3-5-14(12)21-15/h6-10,16H,1-5H2 |
| InChIKey | SSSQJUALTNNZBV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|