About [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol
[6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol (PubChem CID 81238111) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol |
| PubChem CID | 81238111 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol |
| SMILES | Cc1cc(Oc2c(C)ccc(C)c2C)c(CO)cn1 |
| InChI | InChI=1S/C16H19NO2/c1-10-5-6-11(2)16(13(10)4)19-15-7-12(3)17-8-14(15)9-18/h5-8,18H,9H2,1-4H3 |
| InChIKey | PVHLOTHJOVTMSE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol?
The IUPAC name of [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol (CID 81238111) is [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol.
What is the SMILES notation for [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol?
The canonical SMILES for [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol is Cc1cc(Oc2c(C)ccc(C)c2C)c(CO)cn1.
What is the InChIKey of [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol?
The InChIKey is PVHLOTHJOVTMSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-10-5-6-11(2)16(13(10)4)19-15-7-12(3)17-8-14(15)9-18/h5-8,18H,9H2,1-4H3.
What are the key properties of [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol?
[6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol has a molecular weight of 257.33 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-4-(2,3,6-trimethylphenoxy)-3-pyridinyl]methanol is sourced from PubChem (CID 81238111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).