C13H17N5O — CID 81242272
4-(ethylamino)-N-(1-ethylpyrazol-4-yl)pyridine-3-carboxamide (PubChem CID 81242272) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-(ethylamino)-N-(1-ethylpyrazol-4-yl)pyridine-3-carboxamide.
| Compound Name | 4-(ethylamino)-N-(1-ethylpyrazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81242272 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-(ethylamino)-N-(1-ethylpyrazol-4-yl)pyridine-3-carboxamide |
| SMILES | CCNc1ccncc1C(=O)Nc1cnn(CC)c1 |
| InChI | InChI=1S/C13H17N5O/c1-3-15-12-5-6-14-8-11(12)13(19)17-10-7-16-18(4-2)9-10/h5-9H,3-4H2,1-2H3,(H,14,15)(H,17,19) |
| InChIKey | WFBKMEQEFAPIAT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |