C14H16N4O — CID 81242442
4-(methylamino)-N-(2-pyridin-4-ylethyl)pyridine-3-carboxamide (PubChem CID 81242442) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-(methylamino)-N-(2-pyridin-4-ylethyl)pyridine-3-carboxamide.
| Compound Name | 4-(methylamino)-N-(2-pyridin-4-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81242442 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-(methylamino)-N-(2-pyridin-4-ylethyl)pyridine-3-carboxamide |
| SMILES | CNc1ccncc1C(=O)NCCc1ccncc1 |
| InChI | InChI=1S/C14H16N4O/c1-15-13-5-8-17-10-12(13)14(19)18-9-4-11-2-6-16-7-3-11/h2-3,5-8,10H,4,9H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | GSIPIXXYPOVIHS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |