C15H17N3O2 — CID 81242597
4-amino-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-3-carboxamide (PubChem CID 81242597) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-amino-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 4-amino-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81242597 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-amino-N-[(3-methoxyphenyl)methyl]-6-methylpyridine-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cnc(C)cc2N)c1 |
| InChI | InChI=1S/C15H17N3O2/c1-10-6-14(16)13(9-17-10)15(19)18-8-11-4-3-5-12(7-11)20-2/h3-7,9H,8H2,1-2H3,(H2,16,17)(H,18,19) |
| InChIKey | NTQLRRQNETZJIK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |