C14H22N4O2 — CID 81243009
N-[2-(ethylamino)-2-oxoethyl]-6-methyl-4-(propylamino)pyridine-3-carboxamide (PubChem CID 81243009) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-6-methyl-4-(propylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-6-methyl-4-(propylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81243009 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-6-methyl-4-(propylamino)pyridine-3-carboxamide |
| SMILES | CCCNc1cc(C)ncc1C(=O)NCC(=O)NCC |
| InChI | InChI=1S/C14H22N4O2/c1-4-6-16-12-7-10(3)17-8-11(12)14(20)18-9-13(19)15-5-2/h7-8H,4-6,9H2,1-3H3,(H,15,19)(H,16,17)(H,18,20) |
| InChIKey | XJNYLZQBMWVPEI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |