C13H21N3O2 — CID 81243719
4-[1-(diethylamino)propan-2-ylamino]pyridine-3-carboxylic acid (PubChem CID 81243719) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-[1-(diethylamino)propan-2-ylamino]pyridine-3-carboxylic acid.
| Compound Name | 4-[1-(diethylamino)propan-2-ylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81243719 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-[1-(diethylamino)propan-2-ylamino]pyridine-3-carboxylic acid |
| SMILES | CCN(CC)CC(C)Nc1ccncc1C(=O)O |
| InChI | InChI=1S/C13H21N3O2/c1-4-16(5-2)9-10(3)15-12-6-7-14-8-11(12)13(17)18/h6-8,10H,4-5,9H2,1-3H3,(H,14,15)(H,17,18) |
| InChIKey | YQUCCEKROWQKLC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |