About 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one
1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one (PubChem CID 81244474) has the molecular formula C14H15F3N2O2
and a molecular weight of 300.28 g/mol. Its IUPAC name is 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one.
Molecular Properties
| Compound Name | 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one |
| PubChem CID | 81244474 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one |
| SMILES | Cn1c(=O)cc(NCCOCC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C14H15F3N2O2/c1-19-12-5-3-2-4-10(12)11(8-13(19)20)18-6-7-21-9-14(15,16)17/h2-5,8,18H,6-7,9H2,1H3 |
| InChIKey | YSSWKLVBMFKLSX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one?
The IUPAC name of 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one (CID 81244474) is 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one.
What is the SMILES notation for 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one?
The canonical SMILES for 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one is Cn1c(=O)cc(NCCOCC(F)(F)F)c2ccccc21.
What is the InChIKey of 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one?
The InChIKey is YSSWKLVBMFKLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2O2/c1-19-12-5-3-2-4-10(12)11(8-13(19)20)18-6-7-21-9-14(15,16)17/h2-5,8,18H,6-7,9H2,1H3.
What are the key properties of 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one?
1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one has a molecular weight of 300.28 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]quinolin-2-one is sourced from PubChem (CID 81244474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).