C15H15N5O — CID 81244932
N-[(3-cyanophenyl)methyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide (PubChem CID 81244932) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81244932 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide |
| SMILES | Cc1cc(NN)c(C(=O)NCc2cccc(C#N)c2)cn1 |
| InChI | InChI=1S/C15H15N5O/c1-10-5-14(20-17)13(9-18-10)15(21)19-8-12-4-2-3-11(6-12)7-16/h2-6,9H,8,17H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | GYOFFTQWBLZERD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|