C13H16N4O3 — CID 81245242
3,3-dimethyl-4-[4-(methylamino)pyridine-3-carbonyl]piperazine-2,6-dione (PubChem CID 81245242) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3,3-dimethyl-4-[4-(methylamino)pyridine-3-carbonyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[4-(methylamino)pyridine-3-carbonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 81245242 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3,3-dimethyl-4-[4-(methylamino)pyridine-3-carbonyl]piperazine-2,6-dione |
| SMILES | CNc1ccncc1C(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C13H16N4O3/c1-13(2)12(20)16-10(18)7-17(13)11(19)8-6-15-5-4-9(8)14-3/h4-6H,7H2,1-3H3,(H,14,15)(H,16,18,20) |
| InChIKey | STKLJBJXNZKBPY-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|