C14H23N3O — CID 81246052
N-(2,3-dimethylbutyl)-4-(ethylamino)pyridine-3-carboxamide (PubChem CID 81246052) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-4-(ethylamino)pyridine-3-carboxamide.
| Compound Name | N-(2,3-dimethylbutyl)-4-(ethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81246052 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-(2,3-dimethylbutyl)-4-(ethylamino)pyridine-3-carboxamide |
| SMILES | CCNc1ccncc1C(=O)NCC(C)C(C)C |
| InChI | InChI=1S/C14H23N3O/c1-5-16-13-6-7-15-9-12(13)14(18)17-8-11(4)10(2)3/h6-7,9-11H,5,8H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | GSIWXHNUBMIVJD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |