About N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine
N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 81246491) has the molecular formula C14H23N3O2S
and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 81246491 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cnccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-14(2,3)16-11-12-10-15-5-4-13(12)17-6-8-20(18,19)9-7-17/h4-5,10,16H,6-9,11H2,1-3H3 |
| InChIKey | ABOZKNCQKMDTIZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine (CID 81246491) is N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine is CC(C)(C)NCc1cnccc1N1CCS(=O)(=O)CC1.
What is the InChIKey of N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
The InChIKey is ABOZKNCQKMDTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2S/c1-14(2,3)16-11-12-10-15-5-4-13(12)17-6-8-20(18,19)9-7-17/h4-5,10,16H,6-9,11H2,1-3H3.
What are the key properties of N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine?
N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine has a molecular weight of 297.42 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 81246491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).