C16H28N4 — CID 81247566
N-[[4-(4-ethyl-3-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine (PubChem CID 81247566) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is N-[[4-(4-ethyl-3-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine.
| Compound Name | N-[[4-(4-ethyl-3-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 81247566 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N-[[4-(4-ethyl-3-methylpiperazin-1-yl)-3-pyridinyl]methyl]propan-2-amine |
| SMILES | CCN1CCN(c2ccncc2CNC(C)C)CC1C |
| InChI | InChI=1S/C16H28N4/c1-5-19-8-9-20(12-14(19)4)16-6-7-17-10-15(16)11-18-13(2)3/h6-7,10,13-14,18H,5,8-9,11-12H2,1-4H3 |
| InChIKey | SNJQEQFPZKFGPN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |