C13H17N5O3 — CID 81249436
4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 81249436) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 81249436 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-(4-hydrazinyl-6-methylpyridine-3-carbonyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | Cc1cc(NN)c(C(=O)N2CC(=O)NC(=O)C2(C)C)cn1 |
| InChI | InChI=1S/C13H17N5O3/c1-7-4-9(17-14)8(5-15-7)11(20)18-6-10(19)16-12(21)13(18,2)3/h4-5H,6,14H2,1-3H3,(H,15,17)(H,16,19,21) |
| InChIKey | DZKYSMACPFMTLC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|