C11H15F3N4O — CID 81250906
3-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]morpholine (PubChem CID 81250906) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]morpholine.
| Compound Name | 3-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]morpholine |
|---|---|
| PubChem CID | 81250906 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]morpholine |
| SMILES | FC(F)(F)C1CCc2nnc(C3COCCN3)n2C1 |
| InChI | InChI=1S/C11H15F3N4O/c12-11(13,14)7-1-2-9-16-17-10(18(9)5-7)8-6-19-4-3-15-8/h7-8,15H,1-6H2 |
| InChIKey | UGXLYSLBCNATFL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |