C12H17F3N4O — CID 81250907
N-methyl-4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]oxolan-3-amine (PubChem CID 81250907) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is N-methyl-4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]oxolan-3-amine.
| Compound Name | N-methyl-4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 81250907 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-methyl-4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]oxolan-3-amine |
| SMILES | CNC1COCC1c1nnc2n1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C12H17F3N4O/c1-16-9-6-20-5-8(9)11-18-17-10-3-2-7(4-19(10)11)12(13,14)15/h7-9,16H,2-6H2,1H3 |
| InChIKey | DEXIWSZVMVDRBI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |