C10H15F3N4O — CID 81251122
2-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]ethanamine (PubChem CID 81251122) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]ethanamine.
| Compound Name | 2-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 81251122 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]ethanamine |
| SMILES | NCCOCc1nnc2n1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C10H15F3N4O/c11-10(12,13)7-1-2-8-15-16-9(17(8)5-7)6-18-4-3-14/h7H,1-6,14H2 |
| InChIKey | GMBVBEHABPCTPS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|