C13H12Br2N2O2 — CID 81251189
[4-(2,5-dibromo-4-methoxyphenoxy)-3-pyridinyl]methanamine (PubChem CID 81251189) has the molecular formula C13H12Br2N2O2 and a molecular weight of 388.06 g/mol. Its IUPAC name is [4-(2,5-dibromo-4-methoxyphenoxy)-3-pyridinyl]methanamine.
| Compound Name | [4-(2,5-dibromo-4-methoxyphenoxy)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81251189 |
| Molecular Formula | C13H12Br2N2O2 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | [4-(2,5-dibromo-4-methoxyphenoxy)-3-pyridinyl]methanamine |
| SMILES | COc1cc(Br)c(Oc2ccncc2CN)cc1Br |
| InChI | InChI=1S/C13H12Br2N2O2/c1-18-12-4-10(15)13(5-9(12)14)19-11-2-3-17-7-8(11)6-16/h2-5,7H,6,16H2,1H3 |
| InChIKey | SRLDJIFMEUHGKG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |