C13H19F3N4 — CID 81251194
4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclohexan-1-amine (PubChem CID 81251194) has the molecular formula C13H19F3N4 and a molecular weight of 288.32 g/mol. Its IUPAC name is 4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclohexan-1-amine.
| Compound Name | 4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 81251194 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(c2nnc3n2CC(C(F)(F)F)CC3)CC1 |
| InChI | InChI=1S/C13H19F3N4/c14-13(15,16)9-3-6-11-18-19-12(20(11)7-9)8-1-4-10(17)5-2-8/h8-10H,1-7,17H2 |
| InChIKey | CJVIDFLARICBHO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |