C11H13ClF3NOS — CID 81251321
2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 81251321) has the molecular formula C11H13ClF3NOS and a molecular weight of 299.75 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
| Compound Name | 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
|---|---|
| PubChem CID | 81251321 |
| Molecular Formula | C11H13ClF3NOS |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | FC(F)(F)COCCNC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C11H13ClF3NOS/c12-10-5-7-8(1-2-9(7)18-10)16-3-4-17-6-11(13,14)15/h5,8,16H,1-4,6H2 |
| InChIKey | WJDYQJARKVAFQY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|