C11H17F3N4 — CID 81251565
2-methyl-1-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-1-amine (PubChem CID 81251565) has the molecular formula C11H17F3N4 and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-methyl-1-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-1-amine.
| Compound Name | 2-methyl-1-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 81251565 |
| Molecular Formula | C11H17F3N4 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-methyl-1-[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-1-amine |
| SMILES | CC(C)C(N)c1nnc2n1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C11H17F3N4/c1-6(2)9(15)10-17-16-8-4-3-7(5-18(8)10)11(12,13)14/h6-7,9H,3-5,15H2,1-2H3 |
| InChIKey | UGBGYNMTLXLCAH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |