C13H14F2N4 — CID 81252023
2,4-difluoro-5-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline (PubChem CID 81252023) has the molecular formula C13H14F2N4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2,4-difluoro-5-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline.
| Compound Name | 2,4-difluoro-5-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
|---|---|
| PubChem CID | 81252023 |
| Molecular Formula | C13H14F2N4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2,4-difluoro-5-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)aniline |
| SMILES | CC1CCn2c(nnc2-c2cc(N)c(F)cc2F)C1 |
| InChI | InChI=1S/C13H14F2N4/c1-7-2-3-19-12(4-7)17-18-13(19)8-5-11(16)10(15)6-9(8)14/h5-7H,2-4,16H2,1H3 |
| InChIKey | YORZAXBIWXIAIF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|