About 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile
2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile (PubChem CID 81252580) has the molecular formula C14H10Cl2N2S
and a molecular weight of 309.22 g/mol. Its IUPAC name is 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile |
| PubChem CID | 81252580 |
| Molecular Formula | C14H10Cl2N2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile |
| SMILES | N#Cc1cc(NC2CCc3sc(Cl)cc32)ccc1Cl |
| InChI | InChI=1S/C14H10Cl2N2S/c15-11-2-1-9(5-8(11)7-17)18-12-3-4-13-10(12)6-14(16)19-13/h1-2,5-6,12,18H,3-4H2 |
| InChIKey | INKIQZFDCFQNOY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile?
The IUPAC name of 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile (CID 81252580) is 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile.
What is the SMILES notation for 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile?
The canonical SMILES for 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile is N#Cc1cc(NC2CCc3sc(Cl)cc32)ccc1Cl.
What is the InChIKey of 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile?
The InChIKey is INKIQZFDCFQNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2S/c15-11-2-1-9(5-8(11)7-17)18-12-3-4-13-10(12)6-14(16)19-13/h1-2,5-6,12,18H,3-4H2.
What are the key properties of 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile?
2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile has a molecular weight of 309.22 g/mol, XLogP of 5.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]benzonitrile is sourced from PubChem (CID 81252580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).