C9H16N4O — CID 81252760
2-amino-1-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol (PubChem CID 81252760) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-amino-1-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol.
| Compound Name | 2-amino-1-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol |
|---|---|
| PubChem CID | 81252760 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-amino-1-(7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol |
| SMILES | CC1CCn2c(nnc2C(O)CN)C1 |
| InChI | InChI=1S/C9H16N4O/c1-6-2-3-13-8(4-6)11-12-9(13)7(14)5-10/h6-7,14H,2-5,10H2,1H3 |
| InChIKey | IQZUMOUZHYGDTP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |