About 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine
2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 81252766) has the molecular formula C10H12ClNS
and a molecular weight of 213.73 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| PubChem CID | 81252766 |
| Molecular Formula | C10H12ClNS |
| Molecular Weight | 213.73 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | Clc1cc2c(s1)CCC2NC1CC1 |
| InChI | InChI=1S/C10H12ClNS/c11-10-5-7-8(12-6-1-2-6)3-4-9(7)13-10/h5-6,8,12H,1-4H2 |
| InChIKey | OOYAZVQPEWYZEF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.73 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
The IUPAC name of 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (CID 81252766) is 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
What is the SMILES notation for 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
The canonical SMILES for 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine is Clc1cc2c(s1)CCC2NC1CC1.
What is the InChIKey of 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
The InChIKey is OOYAZVQPEWYZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNS/c11-10-5-7-8(12-6-1-2-6)3-4-9(7)13-10/h5-6,8,12H,1-4H2.
What are the key properties of 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine?
2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine has a molecular weight of 213.73 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-cyclopropyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine is sourced from PubChem (CID 81252766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).