(E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid

C9H10N2O4 — CID 81252842

IUPAC(E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid
SMILESO=C(O)/C=C/c1nnc(C2CCCO2)o1
InChIInChI=1S/C9H10N2O4/c12-8(13)4-3-7-10-11-9(15-7)6-2-1-5-14-6/h3-4,6H,1-2,5H2,(H,12,13)/b4-3+
InChIKeyKFYVEJOYJLFQPX-ONEGZZNKSA-N
MW210.19 g/mol
LogP1.02
Rot. Bonds3

About (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid

(E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81252842) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid
PubChem CID81252842
Molecular FormulaC9H10N2O4
Molecular Weight210.19 g/mol
Exact Mass210.06
IUPAC Name(E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid
SMILESO=C(O)/C=C/c1nnc(C2CCCO2)o1
InChIInChI=1S/C9H10N2O4/c12-8(13)4-3-7-10-11-9(15-7)6-2-1-5-14-6/h3-4,6H,1-2,5H2,(H,12,13)/b4-3+
InChIKeyKFYVEJOYJLFQPX-ONEGZZNKSA-N
XLogP1.02
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.19
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid?
The IUPAC name of (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (CID 81252842) is (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid is O=C(O)/C=C/c1nnc(C2CCCO2)o1.
What is the InChIKey of (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid?
The InChIKey is KFYVEJOYJLFQPX-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H10N2O4/c12-8(13)4-3-7-10-11-9(15-7)6-2-1-5-14-6/h3-4,6H,1-2,5H2,(H,12,13)/b4-3+.
What are the key properties of (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid?
(E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid has a molecular weight of 210.19 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid is sourced from PubChem (CID 81252842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).