About [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol
[2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol (PubChem CID 81252902) has the molecular formula C14H14ClNOS
and a molecular weight of 279.79 g/mol. Its IUPAC name is [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol |
| PubChem CID | 81252902 |
| Molecular Formula | C14H14ClNOS |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol |
| SMILES | OCc1ccccc1NC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C14H14ClNOS/c15-14-7-10-12(5-6-13(10)18-14)16-11-4-2-1-3-9(11)8-17/h1-4,7,12,16-17H,5-6,8H2 |
| InChIKey | ZKOSHFPGJUDIAO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol?
The IUPAC name of [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol (CID 81252902) is [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol.
What is the SMILES notation for [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol?
The canonical SMILES for [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol is OCc1ccccc1NC1CCc2sc(Cl)cc21.
What is the InChIKey of [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol?
The InChIKey is ZKOSHFPGJUDIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNOS/c15-14-7-10-12(5-6-13(10)18-14)16-11-4-2-1-3-9(11)8-17/h1-4,7,12,16-17H,5-6,8H2.
What are the key properties of [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol?
[2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol has a molecular weight of 279.79 g/mol, XLogP of 3.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)amino]phenyl]methanol is sourced from PubChem (CID 81252902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).