C12H9ClN2O3 — CID 81252939
(E)-3-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81252939) has the molecular formula C12H9ClN2O3 and a molecular weight of 264.67 g/mol. Its IUPAC name is (E)-3-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81252939 |
| Molecular Formula | C12H9ClN2O3 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (E)-3-[5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(Cc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C12H9ClN2O3/c13-9-3-1-2-8(6-9)7-11-15-14-10(18-11)4-5-12(16)17/h1-6H,7H2,(H,16,17)/b5-4+ |
| InChIKey | MFVTXLFYSCHWKM-SNAWJCMRSA-N |
| XLogP | 2.41 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|