C11H11F3N4 — CID 81254012
N-methyl-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]methanamine (PubChem CID 81254012) has the molecular formula C11H11F3N4 and a molecular weight of 256.23 g/mol. Its IUPAC name is N-methyl-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]methanamine.
| Compound Name | N-methyl-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81254012 |
| Molecular Formula | C11H11F3N4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-methyl-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]-3-pyridinyl]methanamine |
| SMILES | CNCc1cnccc1-n1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H11F3N4/c1-15-6-8-7-16-4-2-9(8)18-5-3-10(17-18)11(12,13)14/h2-5,7,15H,6H2,1H3 |
| InChIKey | LGVVQNVYGTUNOH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |