C15H18BrClN2O2 — CID 81256348
1-(2-bromo-4-chlorophenyl)-3,3-diethyl-1,4-diazepane-2,5-dione (PubChem CID 81256348) has the molecular formula C15H18BrClN2O2 and a molecular weight of 373.68 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-3,3-diethyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-(2-bromo-4-chlorophenyl)-3,3-diethyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 81256348 |
| Molecular Formula | C15H18BrClN2O2 |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-3,3-diethyl-1,4-diazepane-2,5-dione |
| SMILES | CCC1(CC)NC(=O)CCN(c2ccc(Cl)cc2Br)C1=O |
| InChI | InChI=1S/C15H18BrClN2O2/c1-3-15(4-2)14(21)19(8-7-13(20)18-15)12-6-5-10(17)9-11(12)16/h5-6,9H,3-4,7-8H2,1-2H3,(H,18,20) |
| InChIKey | IUCHEBLWGZZQQI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |