C8H13N5O3S — CID 81256506
4-hydrazinyl-N-(2-sulfamoylethyl)pyridine-3-carboxamide (PubChem CID 81256506) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2-sulfamoylethyl)pyridine-3-carboxamide.
| Compound Name | 4-hydrazinyl-N-(2-sulfamoylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81256506 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-hydrazinyl-N-(2-sulfamoylethyl)pyridine-3-carboxamide |
| SMILES | NNc1ccncc1C(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C8H13N5O3S/c9-13-7-1-2-11-5-6(7)8(14)12-3-4-17(10,15)16/h1-2,5H,3-4,9H2,(H,11,13)(H,12,14)(H2,10,15,16) |
| InChIKey | QSSMLFOQGMBMEI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|