C13H23N5O2 — CID 81256702
4-hydrazinyl-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-6-methylpyridine-3-carboxamide (PubChem CID 81256702) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-hydrazinyl-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 4-hydrazinyl-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 81256702 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-hydrazinyl-N-[2-[2-methoxyethyl(methyl)amino]ethyl]-6-methylpyridine-3-carboxamide |
| SMILES | COCCN(C)CCNC(=O)c1cnc(C)cc1NN |
| InChI | InChI=1S/C13H23N5O2/c1-10-8-12(17-14)11(9-16-10)13(19)15-4-5-18(2)6-7-20-3/h8-9H,4-7,14H2,1-3H3,(H,15,19)(H,16,17) |
| InChIKey | RKZZZTUIAACBCJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|