C11H13N5O3 — CID 81257107
8-(imidazole-1-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 81257107) has the molecular formula C11H13N5O3 and a molecular weight of 263.26 g/mol. Its IUPAC name is 8-(imidazole-1-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(imidazole-1-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 81257107 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 8-(imidazole-1-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)n3ccnc3)CC2)N1 |
| InChI | InChI=1S/C11H13N5O3/c17-8-11(14-9(18)13-8)1-4-15(5-2-11)10(19)16-6-3-12-7-16/h3,6-7H,1-2,4-5H2,(H2,13,14,17,18) |
| InChIKey | UCYMONUNBMTSIW-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|