About N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide
N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide (PubChem CID 81257291) has the molecular formula C11H10N4OS
and a molecular weight of 246.30 g/mol. Its IUPAC name is N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide.
Molecular Properties
| Compound Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide |
| PubChem CID | 81257291 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide |
| SMILES | Cc1sc(NC(=O)n2ccnc2)c(C#N)c1C |
| InChI | InChI=1S/C11H10N4OS/c1-7-8(2)17-10(9(7)5-12)14-11(16)15-4-3-13-6-15/h3-4,6H,1-2H3,(H,14,16) |
| InChIKey | ALZWXBUCOZRYKX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide?
The IUPAC name of N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide (CID 81257291) is N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide.
What is the SMILES notation for N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide?
The canonical SMILES for N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide is Cc1sc(NC(=O)n2ccnc2)c(C#N)c1C.
What is the InChIKey of N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide?
The InChIKey is ALZWXBUCOZRYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4OS/c1-7-8(2)17-10(9(7)5-12)14-11(16)15-4-3-13-6-15/h3-4,6H,1-2H3,(H,14,16).
What are the key properties of N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide?
N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide has a molecular weight of 246.30 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyano-4,5-dimethylthiophen-2-yl)imidazole-1-carboxamide is sourced from PubChem (CID 81257291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).