About N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide
N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide (PubChem CID 81257495) has the molecular formula C11H16F3N3O
and a molecular weight of 263.26 g/mol. Its IUPAC name is N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide.
Molecular Properties
| Compound Name | N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide |
| PubChem CID | 81257495 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide |
| SMILES | CCC(CC)N(CC(F)(F)F)C(=O)n1ccnc1 |
| InChI | InChI=1S/C11H16F3N3O/c1-3-9(4-2)17(7-11(12,13)14)10(18)16-6-5-15-8-16/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | NSWZIVDFBXBTPJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide?
The IUPAC name of N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide (CID 81257495) is N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide.
What is the SMILES notation for N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide?
The canonical SMILES for N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide is CCC(CC)N(CC(F)(F)F)C(=O)n1ccnc1.
What is the InChIKey of N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide?
The InChIKey is NSWZIVDFBXBTPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O/c1-3-9(4-2)17(7-11(12,13)14)10(18)16-6-5-15-8-16/h5-6,8-9H,3-4,7H2,1-2H3.
What are the key properties of N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide?
N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide has a molecular weight of 263.26 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-3-yl-N-(2,2,2-trifluoroethyl)imidazole-1-carboxamide is sourced from PubChem (CID 81257495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).