C12H19NO3S — CID 81259126
3-hydroxy-N-methyl-N-(2-methylbutyl)benzenesulfonamide (PubChem CID 81259126) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-hydroxy-N-methyl-N-(2-methylbutyl)benzenesulfonamide.
| Compound Name | 3-hydroxy-N-methyl-N-(2-methylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81259126 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-hydroxy-N-methyl-N-(2-methylbutyl)benzenesulfonamide |
| SMILES | CCC(C)CN(C)S(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C12H19NO3S/c1-4-10(2)9-13(3)17(15,16)12-7-5-6-11(14)8-12/h5-8,10,14H,4,9H2,1-3H3 |
| InChIKey | XCPZTIINVKAMIR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |