C15H16BrNO — CID 81259381
N-(6-bromonaphthalen-2-yl)-3-methylbutanamide (PubChem CID 81259381) has the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. Its IUPAC name is N-(6-bromonaphthalen-2-yl)-3-methylbutanamide.
| Compound Name | N-(6-bromonaphthalen-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 81259381 |
| Molecular Formula | C15H16BrNO |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-(6-bromonaphthalen-2-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C15H16BrNO/c1-10(2)7-15(18)17-14-6-4-11-8-13(16)5-3-12(11)9-14/h3-6,8-10H,7H2,1-2H3,(H,17,18) |
| InChIKey | UAIRGFPUDWFMJW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |