C17H15BrN2 — CID 81259489
1-N-(6-bromonaphthalen-2-yl)-2-methylbenzene-1,4-diamine (PubChem CID 81259489) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 1-N-(6-bromonaphthalen-2-yl)-2-methylbenzene-1,4-diamine.
| Compound Name | 1-N-(6-bromonaphthalen-2-yl)-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 81259489 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-N-(6-bromonaphthalen-2-yl)-2-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1Nc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C17H15BrN2/c1-11-8-15(19)5-7-17(11)20-16-6-3-12-9-14(18)4-2-13(12)10-16/h2-10,20H,19H2,1H3 |
| InChIKey | ZFMGOQKWRHCDQI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|