C9H8N2OS3 — CID 81261206
5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 81261206) has the molecular formula C9H8N2OS3 and a molecular weight of 256.38 g/mol. Its IUPAC name is 5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 81261206 |
| Molecular Formula | C9H8N2OS3 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 5-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cc3c(s2)CCSC3)o1 |
| InChI | InChI=1S/C9H8N2OS3/c13-9-11-10-8(12-9)7-3-5-4-14-2-1-6(5)15-7/h3H,1-2,4H2,(H,11,13) |
| InChIKey | RRBMRUFFFXBYRB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|