C14H18N2OS2 — CID 81261265
N-[[2-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine (PubChem CID 81261265) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[[2-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81261265 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-[[2-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1coc(-c2cc3c(s2)CCSC3)n1 |
| InChI | InChI=1S/C14H18N2OS2/c1-2-4-15-7-11-8-17-14(16-11)13-6-10-9-18-5-3-12(10)19-13/h6,8,15H,2-5,7,9H2,1H3 |
| InChIKey | APGAQUXYQCNCNN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|