C15H14Cl2S2 — CID 81261787
2-[1-chloro-2-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran (PubChem CID 81261787) has the molecular formula C15H14Cl2S2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[1-chloro-2-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran.
| Compound Name | 2-[1-chloro-2-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
|---|---|
| PubChem CID | 81261787 |
| Molecular Formula | C15H14Cl2S2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 2-[1-chloro-2-(2-chlorophenyl)ethyl]-6,7-dihydro-4H-thieno[3,2-c]thiopyran |
| SMILES | Clc1ccccc1CC(Cl)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C15H14Cl2S2/c16-12-4-2-1-3-10(12)7-13(17)15-8-11-9-18-6-5-14(11)19-15/h1-4,8,13H,5-7,9H2 |
| InChIKey | HCKMUNYHXYQEPO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|