C16H23NS2 — CID 81261896
N-[cyclohexen-1-yl(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]ethanamine (PubChem CID 81261896) has the molecular formula C16H23NS2 and a molecular weight of 293.50 g/mol. Its IUPAC name is N-[cyclohexen-1-yl(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]ethanamine.
| Compound Name | N-[cyclohexen-1-yl(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81261896 |
| Molecular Formula | C16H23NS2 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[cyclohexen-1-yl(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C16H23NS2/c1-2-17-16(12-6-4-3-5-7-12)15-10-13-11-18-9-8-14(13)19-15/h6,10,16-17H,2-5,7-9,11H2,1H3 |
| InChIKey | PQZOWVUDXMOCEU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|