C13H14ClFN2O2 — CID 81262930
N-[[5-(3-chloro-2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 81262930) has the molecular formula C13H14ClFN2O2 and a molecular weight of 284.72 g/mol. Its IUPAC name is N-[[5-(3-chloro-2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(3-chloro-2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 81262930 |
| Molecular Formula | C13H14ClFN2O2 |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-[[5-(3-chloro-2-fluorophenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ncoc1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H14ClFN2O2/c1-18-6-5-16-7-11-13(19-8-17-11)9-3-2-4-10(14)12(9)15/h2-4,8,16H,5-7H2,1H3 |
| InChIKey | STPXXUIFXBEGLX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|