C12H11BrClN3 — CID 81263123
2-N-(2-bromo-4-chlorophenyl)-6-methylpyridine-2,3-diamine (PubChem CID 81263123) has the molecular formula C12H11BrClN3 and a molecular weight of 312.60 g/mol. Its IUPAC name is 2-N-(2-bromo-4-chlorophenyl)-6-methylpyridine-2,3-diamine.
| Compound Name | 2-N-(2-bromo-4-chlorophenyl)-6-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 81263123 |
| Molecular Formula | C12H11BrClN3 |
| Molecular Weight | 312.60 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 2-N-(2-bromo-4-chlorophenyl)-6-methylpyridine-2,3-diamine |
| SMILES | Cc1ccc(N)c(Nc2ccc(Cl)cc2Br)n1 |
| InChI | InChI=1S/C12H11BrClN3/c1-7-2-4-10(15)12(16-7)17-11-5-3-8(14)6-9(11)13/h2-6H,15H2,1H3,(H,16,17) |
| InChIKey | RPMAIYYZIGYFTK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |