C12H10BrClFNO — CID 81264965
1-(5-bromofuran-2-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine (PubChem CID 81264965) has the molecular formula C12H10BrClFNO and a molecular weight of 318.57 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromofuran-2-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81264965 |
| Molecular Formula | C12H10BrClFNO |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-1-(3-chloro-2-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Br)o1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C12H10BrClFNO/c1-16-12(9-5-6-10(13)17-9)7-3-2-4-8(14)11(7)15/h2-6,12,16H,1H3 |
| InChIKey | AZBGSYJTJHYSRQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |